PostmodernProph
....fully immersed....
posts like this is why I believe atheists are idiots.....Sorry, but your YEC'ist, literal view of Ark tales
Follow along with the video below to see how to install our site as a web app on your home screen.
Note: This feature currently requires accessing the site using the built-in Safari browser.
posts like this is why I believe atheists are idiots.....Sorry, but your YEC'ist, literal view of Ark tales
it can be scientifically proven that more angels can dance on the head of an atheist than on the head of a pin.......because atheists have flat heads......Cut and paste spam. Typical.you're just a tiresome troll with no imagination.......You poor, angry YEC'ist. Because you're incapable of doing anything but spamming with your tired slogans, just leave now and avoid making a bigger fool of yourself.you're just a tiresome troll with no imagination.......incapable of debating without pretending everyone is a young earther......Even for a simpleton such as yourself, that was pointless and absurd.??....you know the answer to that.....as people spread across the earth, living in different environments, they adapted.....
Your silly bible tales would not account for the repopulation of the planet in a mere few thousand years.
So, let me guess. You're just another angry fundamentalist who can't support their argument.Hollie,
you're just a tiresome troll with no imagination......
Taz, you don't listen. What race was Ham's wife?
It is you who doesn't listen. Ark tales are not a true rendering of historical events.
Did you know that some of the Egyptian pyramids were constructed in the general timeline of the Ark tale. How many Egyptians can dance on the tip of a pyramid?
I thought you were the guy who changes his belief system every time he gets drunk......Am I "DARING"? LOL. Yes I am.
Typical pointless babble. You can't explain why Egyptian civilization was thriving at the time of the Ark tales, so you stutter and mumble.it can be scientifically proven that more angels can dance on the head of an atheist than on the head of a pin.......because atheists have flat heads......Cut and paste spam. Typical.you're just a tiresome troll with no imagination.......You poor, angry YEC'ist. Because you're incapable of doing anything but spamming with your tired slogans, just leave now and avoid making a bigger fool of yourself.you're just a tiresome troll with no imagination.......incapable of debating without pretending everyone is a young earther......Even for a simpleton such as yourself, that was pointless and absurd.
Your silly bible tales would not account for the repopulation of the planet in a mere few thousand years.
So, let me guess. You're just another angry fundamentalist who can't support their argument.Hollie,
you're just a tiresome troll with no imagination......
Taz, you don't listen. What race was Ham's wife?
It is you who doesn't listen. Ark tales are not a true rendering of historical events.
Did you know that some of the Egyptian pyramids were constructed in the general timeline of the Ark tale. How many Egyptians can dance on the tip of a pyramid?
civilization in Egypt started long, long after the flood you silly young earther......Typical pointless babble. You can't explain why Egyptian civilization was thriving at the time of the Ark tales, so you stutter and mumble.it can be scientifically proven that more angels can dance on the head of an atheist than on the head of a pin.......because atheists have flat heads......Cut and paste spam. Typical.you're just a tiresome troll with no imagination.......You poor, angry YEC'ist. Because you're incapable of doing anything but spamming with your tired slogans, just leave now and avoid making a bigger fool of yourself.you're just a tiresome troll with no imagination.......incapable of debating without pretending everyone is a young earther......
So, let me guess. You're just another angry fundamentalist who can't support their argument.Hollie,
you're just a tiresome troll with no imagination......
Taz, you don't listen. What race was Ham's wife?
It is you who doesn't listen. Ark tales are not a true rendering of historical events.
Did you know that some of the Egyptian pyramids were constructed in the general timeline of the Ark tale. How many Egyptians can dance on the tip of a pyramid?
posts like this is why I believe atheists are idiots.....Sorry, but your YEC'ist, literal view of Ark tales
civilization in Egypt started long, long after the flood you silly young earther......Typical pointless babble. You can't explain why Egyptian civilization was thriving at the time of the Ark tales, so you stutter and mumble.it can be scientifically proven that more angels can dance on the head of an atheist than on the head of a pin.......because atheists have flat heads......Cut and paste spam. Typical.you're just a tiresome troll with no imagination.......You poor, angry YEC'ist. Because you're incapable of doing anything but spamming with your tired slogans, just leave now and avoid making a bigger fool of yourself.
So, let me guess. You're just another angry fundamentalist who can't support their argument.Hollie,
you're just a tiresome troll with no imagination......
Taz, you don't listen. What race was Ham's wife?
It is you who doesn't listen. Ark tales are not a true rendering of historical events.
Did you know that some of the Egyptian pyramids were constructed in the general timeline of the Ark tale. How many Egyptians can dance on the tip of a pyramid?
If there was a flood and Noah didn't have any asians or blacks on his boat, where did all the asians and blacks come from?
Here's the answer to the question:
Genesis 6:19, "And of every living thing of all flesh, two of every sort shalt thou bring into the ark, to keep them alive with thee; they shall be male and female."
Two of EVERY FLESH, male and female.
For your enjoyment: The Scientific Case Against Evolution
Name | Abbreviation | Linear structure formula (atom composition and bonding) |
SOURCE: Institute for Chemistry | ||
Alanine | ala | CH3-CH(NH2)-COOH |
Arginine | arg | HN=C(NH2)-NH-(CH2)3-CH(NH2)-COOH |
Asparagine | asn | H2N-CO-CH2-CH(NH2)-COOH |
Aspartic acid | asp | HOOC-CH2-CH(NH2)-COOH |
Cysteine | cys | HS-CH2-CH(NH2)-COOH |
Glutamine | gln | H2N-CO-(CH2)2-CH(NH2)-COOH |
Glutamic acid | glu | HOOC-(CH2)2-CH(NH2)-COOH |
Glycine | gly | NH2-CH2-COOH |
Histidine | his | NH-CH=N-CH=C-CH2-CH(NH2)-COOH |____________| (nitrogen bonded to carbon) |
Isoleucine | ile | CH3-CH2-CH(CH3)-CH(NH2)-COOH |
Leucine | leu | (CH3)2-CH-CH2-CH(NH2)-COOH |
Lysine | lys | H2N-(CH2)4-CH(NH2)-COOH |
Methionine | met | CH3-S-(CH2)2-CH(NH2)-COOH |
Phenylalanine | phe | Ph-CH2-CH(NH2)-COOH |
Proline | pro | NH-(CH2)3-CH-COOH |__________| |
Serine | ser | HO-CH2-CH(NH2)-COOH |
Threonine | thr | CH3-CH(OH)-CH(NH2)-COOH |
Tryptophan | trp | Ph-NH-CH=C-CH2-CH(NH2)-COOH |_________| |
Tyrosine | tyr | HO-Ph-CH2-CH(NH2)-COOH |
Valine | val | (CH3)2-CH-CH(NH2)-COOH |
Ironic, DNA is the argument both for and against God. Sounds like God to me.Actually there is a big case against evolution. DNA. It isn't the fact that it exists. It isn't even the fact that it passes along information needed for a cell to function properly.
Google a video of the making of a cell, and what it entails. It isn't just the complexity of the strands of the amino acids. It is the specified complexity. Those, complex in their own right, strands have to line up specifically, in a coded order on that single cell's DNA before that cell can function correctly. They are pre-wired to know where they belong on the DNA strand, and how to attach properly.
How do you impart information to your computer? You enter a code. Not a random set of 0's and 1's. It has to be specific to work properly.
Bill Gates likened DNA to a computer, with a code more complex than anything we've ever been able to come up with.
So look at what it takes to make the single cell come to life and tell me who entered the code that created those strands of amino acids and the code they followed to make that cell function.
Brought to you by fakes and Charlatans.For your enjoyment: The Scientific Case Against Evolution
Did you happen to notice that there is nothing supernatural about the above?Some one produced these codes. Then, coded these codes so they would know what to do before life can occur. There is a zero probability of a protein molecule happening by chance. Watch one being formed and you will no longer believe in life by chance.
[THEAD] [/THEAD]
Name Abbreviation Linear structure formula (atom composition and bonding) SOURCE: Institute for Chemistry Alanine ala CH3-CH(NH2)-COOH Arginine arg HN=C(NH2)-NH-(CH2)3-CH(NH2)-COOH Asparagine asn H2N-CO-CH2-CH(NH2)-COOH Aspartic acid asp HOOC-CH2-CH(NH2)-COOH Cysteine cys HS-CH2-CH(NH2)-COOH Glutamine gln H2N-CO-(CH2)2-CH(NH2)-COOH Glutamic acid glu HOOC-(CH2)2-CH(NH2)-COOH Glycine gly NH2-CH2-COOH Histidine his NH-CH=N-CH=C-CH2-CH(NH2)-COOH |____________| (nitrogen bonded to carbon) Isoleucine ile CH3-CH2-CH(CH3)-CH(NH2)-COOH Leucine leu (CH3)2-CH-CH2-CH(NH2)-COOH Lysine lys H2N-(CH2)4-CH(NH2)-COOH Methionine met CH3-S-(CH2)2-CH(NH2)-COOH Phenylalanine phe Ph-CH2-CH(NH2)-COOH Proline pro NH-(CH2)3-CH-COOH |__________| Serine ser HO-CH2-CH(NH2)-COOH Threonine thr CH3-CH(OH)-CH(NH2)-COOH Tryptophan trp Ph-NH-CH=C-CH2-CH(NH2)-COOH |_________| Tyrosine tyr HO-Ph-CH2-CH(NH2)-COOH Valine val (CH3)2-CH-CH(NH2)-COOH
[TFOOT] [/TFOOT]
[TBODY] [/TBODY]
More like smog.I love pro christian leaning threads here. It's truly a breath of fresh air.
Sounds like you failed chemistry.Ironic, DNA is the argument both for and against God. Sounds like God to me.Actually there is a big case against evolution. DNA. It isn't the fact that it exists. It isn't even the fact that it passes along information needed for a cell to function properly.
Google a video of the making of a cell, and what it entails. It isn't just the complexity of the strands of the amino acids. It is the specified complexity. Those, complex in their own right, strands have to line up specifically, in a coded order on that single cell's DNA before that cell can function correctly. They are pre-wired to know where they belong on the DNA strand, and how to attach properly.
How do you impart information to your computer? You enter a code. Not a random set of 0's and 1's. It has to be specific to work properly.
Bill Gates likened DNA to a computer, with a code more complex than anything we've ever been able to come up with.
So look at what it takes to make the single cell come to life and tell me who entered the code that created those strands of amino acids and the code they followed to make that cell function.
"Specified complexity". Oh gawd. Slogans and cliches' from a Disco 'tute groupie.Actually there is a big case against evolution. DNA. It isn't the fact that it exists. It isn't even the fact that it passes along information needed for a cell to function properly.
Google a video of the making of a cell, and what it entails. It isn't just the complexity of the strands of the amino acids. It is the specified complexity. Those, complex in their own right, strands have to line up specifically, in a coded order on that single cell's DNA before that cell can function correctly. They are pre-wired to know where they belong on the DNA strand, and how to attach properly.
How do you impart information to your computer? You enter a code. Not a random set of 0's and 1's. It has to be specific to work properly.
Bill Gates likened DNA to a computer, with a code more complex than anything we've ever been able to come up with.
So look at what it takes to make the single cell come to life and tell me who entered the code that created those strands of amino acids and the code they followed to make that cell function.
Why is that?Sounds like you failed chemistry.Ironic, DNA is the argument both for and against God. Sounds like God to me.Actually there is a big case against evolution. DNA. It isn't the fact that it exists. It isn't even the fact that it passes along information needed for a cell to function properly.
Google a video of the making of a cell, and what it entails. It isn't just the complexity of the strands of the amino acids. It is the specified complexity. Those, complex in their own right, strands have to line up specifically, in a coded order on that single cell's DNA before that cell can function correctly. They are pre-wired to know where they belong on the DNA strand, and how to attach properly.
How do you impart information to your computer? You enter a code. Not a random set of 0's and 1's. It has to be specific to work properly.
Bill Gates likened DNA to a computer, with a code more complex than anything we've ever been able to come up with.
So look at what it takes to make the single cell come to life and tell me who entered the code that created those strands of amino acids and the code they followed to make that cell function.
Because nothing about DNA suggests gawds.Why is that?Sounds like you failed chemistry.Ironic, DNA is the argument both for and against God. Sounds like God to me.Actually there is a big case against evolution. DNA. It isn't the fact that it exists. It isn't even the fact that it passes along information needed for a cell to function properly.
Google a video of the making of a cell, and what it entails. It isn't just the complexity of the strands of the amino acids. It is the specified complexity. Those, complex in their own right, strands have to line up specifically, in a coded order on that single cell's DNA before that cell can function correctly. They are pre-wired to know where they belong on the DNA strand, and how to attach properly.
How do you impart information to your computer? You enter a code. Not a random set of 0's and 1's. It has to be specific to work properly.
Bill Gates likened DNA to a computer, with a code more complex than anything we've ever been able to come up with.
So look at what it takes to make the single cell come to life and tell me who entered the code that created those strands of amino acids and the code they followed to make that cell function.