Question about Noah.

[PostmodernProph]

Sorry, but your YEC'ist, literal view of Ark tales

posts like this is why I believe atheists are idiots.....

 

[PostmodernProph]

??....you know the answer to that.....as people spread across the earth, living in different environments, they adapted.....

Even for a simpleton such as yourself, that was pointless and absurd.

Your silly bible tales would not account for the repopulation of the planet in a mere few thousand years.

you're just a tiresome troll with no imagination.......incapable of debating without pretending everyone is a young earther......

You poor, angry YEC'ist. Because you're incapable of doing anything but spamming with your tired slogans, just leave now and avoid making a bigger fool of yourself.

you're just a tiresome troll with no imagination.......

Cut and paste spam. Typical.

Hollie,

you're just a tiresome troll with no imagination......

Taz, you don't listen. What race was Ham's wife?

So, let me guess. You're just another angry fundamentalist who can't support their argument.

It is you who doesn't listen. Ark tales are not a true rendering of historical events.

Did you know that some of the Egyptian pyramids were constructed in the general timeline of the Ark tale. How many Egyptians can dance on the tip of a pyramid?

it can be scientifically proven that more angels can dance on the head of an atheist than on the head of a pin.......because atheists have flat heads......

 

[PostmodernProph]

Am I "DARING"? LOL. Yes I am.

I thought you were the guy who changes his belief system every time he gets drunk......

 

[Hollie]

Even for a simpleton such as yourself, that was pointless and absurd.

Your silly bible tales would not account for the repopulation of the planet in a mere few thousand years.

you're just a tiresome troll with no imagination.......incapable of debating without pretending everyone is a young earther......

You poor, angry YEC'ist. Because you're incapable of doing anything but spamming with your tired slogans, just leave now and avoid making a bigger fool of yourself.

you're just a tiresome troll with no imagination.......

Cut and paste spam. Typical.

Hollie,

you're just a tiresome troll with no imagination......

Taz, you don't listen. What race was Ham's wife?

So, let me guess. You're just another angry fundamentalist who can't support their argument.

It is you who doesn't listen. Ark tales are not a true rendering of historical events.

Did you know that some of the Egyptian pyramids were constructed in the general timeline of the Ark tale. How many Egyptians can dance on the tip of a pyramid?

it can be scientifically proven that more angels can dance on the head of an atheist than on the head of a pin.......because atheists have flat heads......

Typical pointless babble. You can't explain why Egyptian civilization was thriving at the time of the Ark tales, so you stutter and mumble.

 

[PostmodernProph]

you're just a tiresome troll with no imagination.......incapable of debating without pretending everyone is a young earther......

You poor, angry YEC'ist. Because you're incapable of doing anything but spamming with your tired slogans, just leave now and avoid making a bigger fool of yourself.

you're just a tiresome troll with no imagination.......

Cut and paste spam. Typical.

Hollie,

you're just a tiresome troll with no imagination......

Taz, you don't listen. What race was Ham's wife?

So, let me guess. You're just another angry fundamentalist who can't support their argument.

It is you who doesn't listen. Ark tales are not a true rendering of historical events.

Did you know that some of the Egyptian pyramids were constructed in the general timeline of the Ark tale. How many Egyptians can dance on the tip of a pyramid?

it can be scientifically proven that more angels can dance on the head of an atheist than on the head of a pin.......because atheists have flat heads......

Typical pointless babble. You can't explain why Egyptian civilization was thriving at the time of the Ark tales, so you stutter and mumble.

civilization in Egypt started long, long after the flood you silly young earther......

 

[Hollie]

Sorry, but your YEC'ist, literal view of Ark tales

posts like this is why I believe atheists are idiots.....

You poor, angry YEC'ist. Because you're incapable of doing anything but spamming with your tired slogans, just leave now and avoid making a bigger fool of yourself.

you're just a tiresome troll with no imagination.......

Cut and paste spam. Typical.

Hollie,

you're just a tiresome troll with no imagination......

Taz, you don't listen. What race was Ham's wife?

So, let me guess. You're just another angry fundamentalist who can't support their argument.

It is you who doesn't listen. Ark tales are not a true rendering of historical events.

Did you know that some of the Egyptian pyramids were constructed in the general timeline of the Ark tale. How many Egyptians can dance on the tip of a pyramid?

it can be scientifically proven that more angels can dance on the head of an atheist than on the head of a pin.......because atheists have flat heads......

Typical pointless babble. You can't explain why Egyptian civilization was thriving at the time of the Ark tales, so you stutter and mumble.

civilization in Egypt started long, long after the flood you silly young earther......

You YEC'ists have real problems with a reality based worldview.

Aside from the Egyptians, why do the Maya have record of your silly biblical flood.

Problems with a Global Flood 2nd edition

Why is there no mention of the Flood in the records of Egyptian or Mesopotamian civilizations which existed at the time?

Biblical dates (I Kings 6:1, Gal 3:17, various generation lengths given in Genesis) place the Flood 1300 years before Solomon began the first temple. We can construct reliable chronologies for near Eastern history, particularly for Egypt, from many kinds of records from the literate cultures in the near East. These records are independent of, but supported by, dating methods such as dendrochronology and carbon-14. The building of the first temple can be dated to 950 B.C. +/- some small delta, placing the Flood around 2250 B.C. Unfortunately, the Egyptians (among others) have written records dating well back before 2250 B.C. (the Great Pyramid, for example dates to the 26th century B.C., 300 years before the Biblical date for the Flood). No sign in Egyptian inscriptions of this global flood around 2250 B.C.

 

[the_human_being]

For your enjoyment: The Scientific Case Against Evolution

 

[jillian]

If there was a flood and Noah didn't have any asians or blacks on his boat, where did all the asians and blacks come from?

Here's the answer to the question:

Genesis 6:19, "And of every living thing of all flesh, two of every sort shalt thou bring into the ark, to keep them alive with thee; they shall be male and female."

Two of EVERY FLESH, male and female.

that's nice. you know these stories are allegory and not to be taken literally, right?

 

[jillian]

For your enjoyment: The Scientific Case Against Evolution

there is no scientific case against evolution. there are only radical religious right arguments that have zero to do with science

 

[The Irish Ram]

Actually there is a big case against evolution. DNA. It isn't the fact that it exists. It isn't even the fact that it passes along information needed for a cell to function properly.

Google a video of the making of a cell, and what it entails. It isn't just the complexity of the strands of the amino acids. It is the specified complexity. Those, complex in their own right, strands have to line up specifically, in a coded order on that single cell's DNA before that cell can function correctly. They are pre-wired to know where they belong on the DNA strand, and how to attach properly.

How do you impart information to your computer? You enter a code. Not a random set of 0's and 1's. It has to be specific to work properly.
Bill Gates likened DNA to a computer, with a code more complex than anything we've ever been able to come up with.

So look at what it takes to make the single cell come to life and tell me who entered the code that created those strands of amino acids and the code they followed to make that cell function.

 

[The Irish Ram]

Some one produced these codes. Then, coded these codes so they would know what to do before life can occur. There is a zero probability of a protein molecule happening by chance. Watch one being formed and you will no longer believe in life by chance.

Name	Abbreviation	Linear structure formula (atom composition and bonding)
SOURCE: Institute for Chemistry
Alanine	ala	CH3-CH(NH2)-COOH
Arginine	arg	HN=C(NH2)-NH-(CH2)3-CH(NH2)-COOH
Asparagine	asn	H2N-CO-CH2-CH(NH2)-COOH
Aspartic acid	asp	HOOC-CH2-CH(NH2)-COOH
Cysteine	cys	HS-CH2-CH(NH2)-COOH
Glutamine	gln	H2N-CO-(CH2)2-CH(NH2)-COOH
Glutamic acid	glu	HOOC-(CH2)2-CH(NH2)-COOH
Glycine	gly	NH2-CH2-COOH
Histidine	his	NH-CH=N-CH=C-CH2-CH(NH2)-COOH |____________| (nitrogen bonded to carbon)
Isoleucine	ile	CH3-CH2-CH(CH3)-CH(NH2)-COOH
Leucine	leu	(CH3)2-CH-CH2-CH(NH2)-COOH
Lysine	lys	H2N-(CH2)4-CH(NH2)-COOH
Methionine	met	CH3-S-(CH2)2-CH(NH2)-COOH
Phenylalanine	phe	Ph-CH2-CH(NH2)-COOH
Proline	pro	NH-(CH2)3-CH-COOH |__________|
Serine	ser	HO-CH2-CH(NH2)-COOH
Threonine	thr	CH3-CH(OH)-CH(NH2)-COOH
Tryptophan	trp	Ph-NH-CH=C-CH2-CH(NH2)-COOH |_________|
Tyrosine	tyr	HO-Ph-CH2-CH(NH2)-COOH
Valine	val	(CH3)2-CH-CH(NH2)-COOH

[THEAD] [/THEAD]
[TFOOT] [/TFOOT]
[TBODY] [/TBODY]

 

[RandomVariable]

Actually there is a big case against evolution. DNA. It isn't the fact that it exists. It isn't even the fact that it passes along information needed for a cell to function properly.

Google a video of the making of a cell, and what it entails. It isn't just the complexity of the strands of the amino acids. It is the specified complexity. Those, complex in their own right, strands have to line up specifically, in a coded order on that single cell's DNA before that cell can function correctly. They are pre-wired to know where they belong on the DNA strand, and how to attach properly.

How do you impart information to your computer? You enter a code. Not a random set of 0's and 1's. It has to be specific to work properly.
Bill Gates likened DNA to a computer, with a code more complex than anything we've ever been able to come up with.

So look at what it takes to make the single cell come to life and tell me who entered the code that created those strands of amino acids and the code they followed to make that cell function.

Ironic, DNA is the argument both for and against God. Sounds like God to me.

 

[Judicial review]

I love pro christian leaning threads here. It's truly a breath of fresh air.

 

[Hollie]

For your enjoyment: The Scientific Case Against Evolution

Brought to you by fakes and Charlatans.

 

[Hollie]

Some one produced these codes. Then, coded these codes so they would know what to do before life can occur. There is a zero probability of a protein molecule happening by chance. Watch one being formed and you will no longer believe in life by chance.

Name	Abbreviation	Linear structure formula (atom composition and bonding)
SOURCE: Institute for Chemistry
Alanine	ala	CH3-CH(NH2)-COOH
Arginine	arg	HN=C(NH2)-NH-(CH2)3-CH(NH2)-COOH
Asparagine	asn	H2N-CO-CH2-CH(NH2)-COOH
Aspartic acid	asp	HOOC-CH2-CH(NH2)-COOH
Cysteine	cys	HS-CH2-CH(NH2)-COOH
Glutamine	gln	H2N-CO-(CH2)2-CH(NH2)-COOH
Glutamic acid	glu	HOOC-(CH2)2-CH(NH2)-COOH
Glycine	gly	NH2-CH2-COOH
Histidine	his	NH-CH=N-CH=C-CH2-CH(NH2)-COOH |____________| (nitrogen bonded to carbon)
Isoleucine	ile	CH3-CH2-CH(CH3)-CH(NH2)-COOH
Leucine	leu	(CH3)2-CH-CH2-CH(NH2)-COOH
Lysine	lys	H2N-(CH2)4-CH(NH2)-COOH
Methionine	met	CH3-S-(CH2)2-CH(NH2)-COOH
Phenylalanine	phe	Ph-CH2-CH(NH2)-COOH
Proline	pro	NH-(CH2)3-CH-COOH |__________|
Serine	ser	HO-CH2-CH(NH2)-COOH
Threonine	thr	CH3-CH(OH)-CH(NH2)-COOH
Tryptophan	trp	Ph-NH-CH=C-CH2-CH(NH2)-COOH |_________|
Tyrosine	tyr	HO-Ph-CH2-CH(NH2)-COOH
Valine	val	(CH3)2-CH-CH(NH2)-COOH

[THEAD] [/THEAD]
[TFOOT] [/TFOOT]
[TBODY] [/TBODY]

Did you happen to notice that there is nothing supernatural about the above?

 

[Hollie]

I love pro christian leaning threads here. It's truly a breath of fresh air.

More like smog.

 

[Hollie]

Actually there is a big case against evolution. DNA. It isn't the fact that it exists. It isn't even the fact that it passes along information needed for a cell to function properly.

Google a video of the making of a cell, and what it entails. It isn't just the complexity of the strands of the amino acids. It is the specified complexity. Those, complex in their own right, strands have to line up specifically, in a coded order on that single cell's DNA before that cell can function correctly. They are pre-wired to know where they belong on the DNA strand, and how to attach properly.

How do you impart information to your computer? You enter a code. Not a random set of 0's and 1's. It has to be specific to work properly.
Bill Gates likened DNA to a computer, with a code more complex than anything we've ever been able to come up with.

So look at what it takes to make the single cell come to life and tell me who entered the code that created those strands of amino acids and the code they followed to make that cell function.

Ironic, DNA is the argument both for and against God. Sounds like God to me.

Sounds like you failed chemistry.

 

[Hollie]

Actually there is a big case against evolution. DNA. It isn't the fact that it exists. It isn't even the fact that it passes along information needed for a cell to function properly.

Google a video of the making of a cell, and what it entails. It isn't just the complexity of the strands of the amino acids. It is the specified complexity. Those, complex in their own right, strands have to line up specifically, in a coded order on that single cell's DNA before that cell can function correctly. They are pre-wired to know where they belong on the DNA strand, and how to attach properly.

How do you impart information to your computer? You enter a code. Not a random set of 0's and 1's. It has to be specific to work properly.
Bill Gates likened DNA to a computer, with a code more complex than anything we've ever been able to come up with.

So look at what it takes to make the single cell come to life and tell me who entered the code that created those strands of amino acids and the code they followed to make that cell function.

"Specified complexity". Oh gawd. Slogans and cliches' from a Disco 'tute groupie.

 

[RandomVariable]

Actually there is a big case against evolution. DNA. It isn't the fact that it exists. It isn't even the fact that it passes along information needed for a cell to function properly.

Google a video of the making of a cell, and what it entails. It isn't just the complexity of the strands of the amino acids. It is the specified complexity. Those, complex in their own right, strands have to line up specifically, in a coded order on that single cell's DNA before that cell can function correctly. They are pre-wired to know where they belong on the DNA strand, and how to attach properly.

How do you impart information to your computer? You enter a code. Not a random set of 0's and 1's. It has to be specific to work properly.
Bill Gates likened DNA to a computer, with a code more complex than anything we've ever been able to come up with.

So look at what it takes to make the single cell come to life and tell me who entered the code that created those strands of amino acids and the code they followed to make that cell function.

Ironic, DNA is the argument both for and against God. Sounds like God to me.

Sounds like you failed chemistry.

Why is that?

 

[Hollie]

Actually there is a big case against evolution. DNA. It isn't the fact that it exists. It isn't even the fact that it passes along information needed for a cell to function properly.

Google a video of the making of a cell, and what it entails. It isn't just the complexity of the strands of the amino acids. It is the specified complexity. Those, complex in their own right, strands have to line up specifically, in a coded order on that single cell's DNA before that cell can function correctly. They are pre-wired to know where they belong on the DNA strand, and how to attach properly.

How do you impart information to your computer? You enter a code. Not a random set of 0's and 1's. It has to be specific to work properly.
Bill Gates likened DNA to a computer, with a code more complex than anything we've ever been able to come up with.

So look at what it takes to make the single cell come to life and tell me who entered the code that created those strands of amino acids and the code they followed to make that cell function.

Ironic, DNA is the argument both for and against God. Sounds like God to me.

Sounds like you failed chemistry.

Why is that?

Because nothing about DNA suggests gawds.